Network Topology and Network Structure are fundamental concepts in the field of Information Management Systems, particularly in tourism, where effective communication, data transfer, and system management are crucial for operations like reservations, customer management, and travel coordination. Both terms are often used interchangeably, but they have distinct meanings and implications for the design and management of networks in tourism organizations. Network Topology refers to the physical or logical arrangement of network devices, such as computers, servers, routers, and switches, and the connections between them. It defines how data flows within a network and how devices communicate with each other. Network topology can be visualized as a map showing the paths data takes and the interconnections between nodes. There are several common types of network topologies: 1. Bus Topology: In bus topology, all devices are connected to a single central cable, known as the backbone. Data travels in both directions along the bus, and each device checks whether the data is meant for it. This topology is simple and cost-effective but has limitations in terms of scalability and fault tolerance. If the main cable fails, the entire network goes down. In a tourism context, a small travel agency might use a bus topology to connect computers for ticketing, reservations, and internal communication. *Diagram (Bus Topology)* ``` [PC1]---[PC2]---[PC3]---[PC4] (Single Backbone Cable) ``` 2. Star Topology: In star topology, all devices are connected to a central hub or switch. Each